C24H34N6O3S — CID 92890499
5-[(3R)-3-[3-(diethylamino)propylcarbamoyl]piperidine-1-carbonyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92890499) has the molecular formula C24H34N6O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 5-[(3R)-3-[3-(diethylamino)propylcarbamoyl]piperidine-1-carbonyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(3R)-3-[3-(diethylamino)propylcarbamoyl]piperidine-1-carbonyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92890499 |
| Molecular Formula | C24H34N6O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 5-[(3R)-3-[3-(diethylamino)propylcarbamoyl]piperidine-1-carbonyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)[C@@H]1CCCN(C(=O)c2nnc(C(=O)Nc3ccc(C)cc3)s2)C1 |
| InChI | InChI=1S/C24H34N6O3S/c1-4-29(5-2)14-7-13-25-20(31)18-8-6-15-30(16-18)24(33)23-28-27-22(34-23)21(32)26-19-11-9-17(3)10-12-19/h9-12,18H,4-8,13-16H2,1-3H3,(H,25,31)(H,26,32)/t18-/m1/s1 |
| InChIKey | YXJOACMGGUTTDA-GOSISDBHSA-N |
| XLogP | 2.80 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|