C21H25N5O5S — CID 92890917
N-(1,3-benzodioxol-5-yl)-5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 92890917) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 92890917 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-[(3R)-3-(butylcarbamoyl)piperidine-1-carbonyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN(C(=O)c2nnc(C(=O)Nc3ccc4c(c3)OCO4)s2)C1 |
| InChI | InChI=1S/C21H25N5O5S/c1-2-3-8-22-17(27)13-5-4-9-26(11-13)21(29)20-25-24-19(32-20)18(28)23-14-6-7-15-16(10-14)31-12-30-15/h6-7,10,13H,2-5,8-9,11-12H2,1H3,(H,22,27)(H,23,28)/t13-/m1/s1 |
| InChIKey | SMSBMZXWEBAVAI-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|