C14H16N2O5 — CID 43318323
1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 43318323) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 43318323 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C14H16N2O5/c17-13(18)9-2-1-5-16(7-9)14(19)15-10-3-4-11-12(6-10)21-8-20-11/h3-4,6,9H,1-2,5,7-8H2,(H,15,19)(H,17,18) |
| InChIKey | CLHLEYLRZJMRON-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |