1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid

C14H16N2O5 — CID 43318323

IUPAC1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1
InChIInChI=1S/C14H16N2O5/c17-13(18)9-2-1-5-16(7-9)14(19)15-10-3-4-11-12(6-10)21-8-20-11/h3-4,6,9H,1-2,5,7-8H2,(H,15,19)(H,17,18)
InChIKeyCLHLEYLRZJMRON-UHFFFAOYSA-N
MW292.29 g/mol
LogP1.74
Rot. Bonds2

About 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid

1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 43318323) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid
PubChem CID43318323
Molecular FormulaC14H16N2O5
Molecular Weight292.29 g/mol
Exact Mass292.11
IUPAC Name1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1
InChIInChI=1S/C14H16N2O5/c17-13(18)9-2-1-5-16(7-9)14(19)15-10-3-4-11-12(6-10)21-8-20-11/h3-4,6,9H,1-2,5,7-8H2,(H,15,19)(H,17,18)
InChIKeyCLHLEYLRZJMRON-UHFFFAOYSA-N
XLogP1.74
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.29
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid (CID 43318323) is 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid is O=C(O)C1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1.
What is the InChIKey of 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid?
The InChIKey is CLHLEYLRZJMRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5/c17-13(18)9-2-1-5-16(7-9)14(19)15-10-3-4-11-12(6-10)21-8-20-11/h3-4,6,9H,1-2,5,7-8H2,(H,15,19)(H,17,18).
What are the key properties of 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid?
1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid has a molecular weight of 292.29 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-ylcarbamoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 43318323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).