C22H22N2O5 — CID 42147863
(3R)-N-(4-acetylphenyl)-3-(1,3-benzodioxole-5-carbonyl)piperidine-1-carboxamide (PubChem CID 42147863) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (3R)-N-(4-acetylphenyl)-3-(1,3-benzodioxole-5-carbonyl)piperidine-1-carboxamide.
| Compound Name | (3R)-N-(4-acetylphenyl)-3-(1,3-benzodioxole-5-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42147863 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3R)-N-(4-acetylphenyl)-3-(1,3-benzodioxole-5-carbonyl)piperidine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CCC[C@@H](C(=O)c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-14(25)15-4-7-18(8-5-15)23-22(27)24-10-2-3-17(12-24)21(26)16-6-9-19-20(11-16)29-13-28-19/h4-9,11,17H,2-3,10,12-13H2,1H3,(H,23,27)/t17-/m1/s1 |
| InChIKey | HWHDKMKAYLOHTM-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |