C21H22N2O5 — CID 42567311
(3R)-N-(1,3-benzodioxol-5-yl)-3-(2-methoxybenzoyl)piperidine-1-carboxamide (PubChem CID 42567311) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (3R)-N-(1,3-benzodioxol-5-yl)-3-(2-methoxybenzoyl)piperidine-1-carboxamide.
| Compound Name | (3R)-N-(1,3-benzodioxol-5-yl)-3-(2-methoxybenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42567311 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (3R)-N-(1,3-benzodioxol-5-yl)-3-(2-methoxybenzoyl)piperidine-1-carboxamide |
| SMILES | COc1ccccc1C(=O)[C@@H]1CCCN(C(=O)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C21H22N2O5/c1-26-17-7-3-2-6-16(17)20(24)14-5-4-10-23(12-14)21(25)22-15-8-9-18-19(11-15)28-13-27-18/h2-3,6-9,11,14H,4-5,10,12-13H2,1H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | KLHZQSCKVSRNHQ-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |