C15H20N2O5S — CID 45176869
3-(1,3-benzodioxole-5-carbonyl)-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 45176869) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxole-5-carbonyl)-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 3-(1,3-benzodioxole-5-carbonyl)-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 45176869 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-(1,3-benzodioxole-5-carbonyl)-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C15H20N2O5S/c1-16(2)23(19,20)17-7-3-4-12(9-17)15(18)11-5-6-13-14(8-11)22-10-21-13/h5-6,8,12H,3-4,7,9-10H2,1-2H3 |
| InChIKey | XSNMULYSWRUTNX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |