C16H10ClF2N3O2 — CID 59992512
5-chloro-N'-(2,3-difluorobenzoyl)-1H-indole-2-carbohydrazide (PubChem CID 59992512) has the molecular formula C16H10ClF2N3O2 and a molecular weight of 349.72 g/mol. Its IUPAC name is 5-chloro-N'-(2,3-difluorobenzoyl)-1H-indole-2-carbohydrazide.
| Compound Name | 5-chloro-N'-(2,3-difluorobenzoyl)-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 59992512 |
| Molecular Formula | C16H10ClF2N3O2 |
| Molecular Weight | 349.72 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 5-chloro-N'-(2,3-difluorobenzoyl)-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(F)c1F)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C16H10ClF2N3O2/c17-9-4-5-12-8(6-9)7-13(20-12)16(24)22-21-15(23)10-2-1-3-11(18)14(10)19/h1-7,20H,(H,21,23)(H,22,24) |
| InChIKey | YGHZASVPOIBEBI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|