C17H16ClFN4O4S — CID 87986666
N-[(5-chloro-1H-indole-2-carbonyl)amino]-N'-(2-fluorophenyl)methanimidamide;methanesulfonic acid (PubChem CID 87986666) has the molecular formula C17H16ClFN4O4S and a molecular weight of 426.86 g/mol. Its IUPAC name is N-[(5-chloro-1H-indole-2-carbonyl)amino]-N'-(2-fluorophenyl)methanimidamide;methanesulfonic acid.
| Compound Name | N-[(5-chloro-1H-indole-2-carbonyl)amino]-N'-(2-fluorophenyl)methanimidamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87986666 |
| Molecular Formula | C17H16ClFN4O4S |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[(5-chloro-1H-indole-2-carbonyl)amino]-N'-(2-fluorophenyl)methanimidamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(NN/C=N/c1ccccc1F)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C16H12ClFN4O.CH4O3S/c17-11-5-6-13-10(7-11)8-15(21-13)16(23)22-20-9-19-14-4-2-1-3-12(14)18;1-5(2,3)4/h1-9,21H,(H,19,20)(H,22,23);1H3,(H,2,3,4) |
| InChIKey | IEGCEUUTGZVZTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|