C22H16ClN3O2 — CID 10293735
5-chloro-N'-(2-phenylbenzoyl)-1H-indole-2-carbohydrazide (PubChem CID 10293735) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is 5-chloro-N'-(2-phenylbenzoyl)-1H-indole-2-carbohydrazide.
| Compound Name | 5-chloro-N'-(2-phenylbenzoyl)-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 10293735 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-chloro-N'-(2-phenylbenzoyl)-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1-c1ccccc1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C22H16ClN3O2/c23-16-10-11-19-15(12-16)13-20(24-19)22(28)26-25-21(27)18-9-5-4-8-17(18)14-6-2-1-3-7-14/h1-13,24H,(H,25,27)(H,26,28) |
| InChIKey | ANMPPZLWQYNSEF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|