C24H19ClN4O6S — CID 87987049
[2-[[(5-chloro-1H-indole-2-carbonyl)amino]carbamoyl]phenyl]carbamoyl 4-methylbenzenesulfonate (PubChem CID 87987049) has the molecular formula C24H19ClN4O6S and a molecular weight of 526.96 g/mol. Its IUPAC name is [2-[[(5-chloro-1H-indole-2-carbonyl)amino]carbamoyl]phenyl]carbamoyl 4-methylbenzenesulfonate.
| Compound Name | [2-[[(5-chloro-1H-indole-2-carbonyl)amino]carbamoyl]phenyl]carbamoyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87987049 |
| Molecular Formula | C24H19ClN4O6S |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | [2-[[(5-chloro-1H-indole-2-carbonyl)amino]carbamoyl]phenyl]carbamoyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)Nc2ccccc2C(=O)NNC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H19ClN4O6S/c1-14-6-9-17(10-7-14)36(33,34)35-24(32)27-20-5-3-2-4-18(20)22(30)28-29-23(31)21-13-15-12-16(25)8-11-19(15)26-21/h2-13,26H,1H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | YRRKVHOLAXPVIM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|