C27H23BrFN3O2 — CID 70919144
N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxamide (PubChem CID 70919144) has the molecular formula C27H23BrFN3O2 and a molecular weight of 520.40 g/mol. Its IUPAC name is N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70919144 |
| Molecular Formula | C27H23BrFN3O2 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxamide |
| SMILES | Cc1[nH]c2c(F)cc(Br)cc2c1CCNC(=O)c1cc2cc(OCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C27H23BrFN3O2/c1-16-21(22-13-19(28)14-23(29)26(22)31-16)9-10-30-27(33)25-12-18-11-20(7-8-24(18)32-25)34-15-17-5-3-2-4-6-17/h2-8,11-14,31-32H,9-10,15H2,1H3,(H,30,33) |
| InChIKey | RVGZSIZLMBDPEG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|