C21H16BrF4N3O2 — CID 70920633
N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-(trifluoromethoxy)-1H-indole-2-carboxamide (PubChem CID 70920633) has the molecular formula C21H16BrF4N3O2 and a molecular weight of 498.27 g/mol. Its IUPAC name is N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-(trifluoromethoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-(trifluoromethoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70920633 |
| Molecular Formula | C21H16BrF4N3O2 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | N-[2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethyl]-5-(trifluoromethoxy)-1H-indole-2-carboxamide |
| SMILES | Cc1[nH]c2c(F)cc(Br)cc2c1CCNC(=O)c1cc2cc(OC(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C21H16BrF4N3O2/c1-10-14(15-8-12(22)9-16(23)19(15)28-10)4-5-27-20(30)18-7-11-6-13(31-21(24,25)26)2-3-17(11)29-18/h2-3,6-9,28-29H,4-5H2,1H3,(H,27,30) |
| InChIKey | SAPRHMLKNDRZSS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|