C17H15F3N2O2S — CID 617829
N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]thiophene-2-carboxamide (PubChem CID 617829) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 617829 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C17H15F3N2O2S/c1-10-12(6-7-21-16(23)15-3-2-8-25-15)13-9-11(24-17(18,19)20)4-5-14(13)22-10/h2-5,8-9,22H,6-7H2,1H3,(H,21,23) |
| InChIKey | HTIBGERZQVDGQY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|