C19H16ClF2N3O4 — CID 44616010
N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-3-nitrobenzamide (PubChem CID 44616010) has the molecular formula C19H16ClF2N3O4 and a molecular weight of 423.80 g/mol. Its IUPAC name is N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 44616010 |
| Molecular Formula | C19H16ClF2N3O4 |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-3-nitrobenzamide |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)Cl)cc2c1CCNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClF2N3O4/c1-11-15(16-10-14(29-19(20,21)22)5-6-17(16)24-11)7-8-23-18(26)12-3-2-4-13(9-12)25(27)28/h2-6,9-10,24H,7-8H2,1H3,(H,23,26) |
| InChIKey | ZQQLLIVJOJQDQX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|