C18H16F3N3O2 — CID 617833
N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 617833) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 617833 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1CCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H16F3N3O2/c1-11-14(6-8-23-17(25)12-3-2-7-22-10-12)15-9-13(26-18(19,20)21)4-5-16(15)24-11/h2-5,7,9-10,24H,6,8H2,1H3,(H,23,25) |
| InChIKey | MRPNVNZSOGGOCD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|