C20H17FN4O — CID 91949032
N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1,6-naphthyridine-8-carboxamide (PubChem CID 91949032) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1,6-naphthyridine-8-carboxamide.
| Compound Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1,6-naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 91949032 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-1,6-naphthyridine-8-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CCNC(=O)c1cncc2cccnc12 |
| InChI | InChI=1S/C20H17FN4O/c1-12-15(16-9-14(21)4-5-18(16)25-12)6-8-24-20(26)17-11-22-10-13-3-2-7-23-19(13)17/h2-5,7,9-11,25H,6,8H2,1H3,(H,24,26) |
| InChIKey | GBVUFHUPBQOFGO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|