C13H17FN2 — CID 82494090
N-ethyl-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine (PubChem CID 82494090) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is N-ethyl-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine.
| Compound Name | N-ethyl-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82494090 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N-ethyl-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine |
| SMILES | CCNCCc1c(C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C13H17FN2/c1-3-15-7-6-11-9(2)16-13-5-4-10(14)8-12(11)13/h4-5,8,15-16H,3,6-7H2,1-2H3 |
| InChIKey | IBEUNNNHFFVPSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|