C22H16ClF2N3O6 — CID 1262802
N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-6-nitro-2-oxochromene-3-carboxamide (PubChem CID 1262802) has the molecular formula C22H16ClF2N3O6 and a molecular weight of 491.83 g/mol. Its IUPAC name is N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-6-nitro-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-6-nitro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1262802 |
| Molecular Formula | C22H16ClF2N3O6 |
| Molecular Weight | 491.83 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[2-[5-[chloro(difluoro)methoxy]-2-methyl-1H-indol-3-yl]ethyl]-6-nitro-2-oxochromene-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)Cl)cc2c1CCNC(=O)c1cc2cc([N+](=O)[O-])ccc2oc1=O |
| InChI | InChI=1S/C22H16ClF2N3O6/c1-11-15(16-10-14(34-22(23,24)25)3-4-18(16)27-11)6-7-26-20(29)17-9-12-8-13(28(31)32)2-5-19(12)33-21(17)30/h2-5,8-10,27H,6-7H2,1H3,(H,26,29) |
| InChIKey | JDGBTDXOPAHYFA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|