About N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide
N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide (PubChem CID 39854653) has the molecular formula C18H19ClN2O2
and a molecular weight of 330.82 g/mol. Its IUPAC name is N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide |
| PubChem CID | 39854653 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1[nH]c2c(C)ccc(Cl)c2c1CCNC(=O)c1ccoc1C |
| InChI | InChI=1S/C18H19ClN2O2/c1-10-4-5-15(19)16-13(11(2)21-17(10)16)6-8-20-18(22)14-7-9-23-12(14)3/h4-5,7,9,21H,6,8H2,1-3H3,(H,20,22) |
| InChIKey | UAJKJXOWPMVEKB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide?
The IUPAC name of N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide (CID 39854653) is N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide.
What is the SMILES notation for N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide?
The canonical SMILES for N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide is Cc1[nH]c2c(C)ccc(Cl)c2c1CCNC(=O)c1ccoc1C.
What is the InChIKey of N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide?
The InChIKey is UAJKJXOWPMVEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O2/c1-10-4-5-15(19)16-13(11(2)21-17(10)16)6-8-20-18(22)14-7-9-23-12(14)3/h4-5,7,9,21H,6,8H2,1-3H3,(H,20,22).
What are the key properties of N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide?
N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide has a molecular weight of 330.82 g/mol, XLogP of 4.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethyl]-2-methylfuran-3-carboxamide is sourced from PubChem (CID 39854653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).