C12H16ClN2+ — CID 6983621
2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium (PubChem CID 6983621) has the molecular formula C12H16ClN2+ and a molecular weight of 223.73 g/mol. Its IUPAC name is 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium.
| Compound Name | 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium |
|---|---|
| PubChem CID | 6983621 |
| Molecular Formula | C12H16ClN2+ |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium |
| SMILES | Cc1[nH]c2c(C)ccc(Cl)c2c1CC[NH3+] |
| InChI | InChI=1S/C12H15ClN2/c1-7-3-4-10(13)11-9(5-6-14)8(2)15-12(7)11/h3-4,15H,5-6,14H2,1-2H3/p+1 |
| InChIKey | SIPAOIBEPJIPPY-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |