About 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium
2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium (PubChem CID 6983621) has the molecular formula C12H16ClN2+
and a molecular weight of 223.73 g/mol. Its IUPAC name is 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium.
Molecular Properties
| Compound Name | 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium |
| PubChem CID | 6983621 |
| Molecular Formula | C12H16ClN2+ |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium |
| SMILES | Cc1[nH]c2c(C)ccc(Cl)c2c1CC[NH3+] |
| InChI | InChI=1S/C12H15ClN2/c1-7-3-4-10(13)11-9(5-6-14)8(2)15-12(7)11/h3-4,15H,5-6,14H2,1-2H3/p+1 |
| InChIKey | SIPAOIBEPJIPPY-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium?
The IUPAC name of 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium (CID 6983621) is 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium.
What is the SMILES notation for 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium?
The canonical SMILES for 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium is Cc1[nH]c2c(C)ccc(Cl)c2c1CC[NH3+].
What is the InChIKey of 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium?
The InChIKey is SIPAOIBEPJIPPY-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H15ClN2/c1-7-3-4-10(13)11-9(5-6-14)8(2)15-12(7)11/h3-4,15H,5-6,14H2,1-2H3/p+1.
What are the key properties of 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium?
2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium has a molecular weight of 223.73 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,7-dimethyl-1H-indol-3-yl)ethylazanium is sourced from PubChem (CID 6983621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).