C14H20N2 — CID 82393603
3-(2,4,7-trimethyl-1H-indol-3-yl)propan-1-amine (PubChem CID 82393603) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-(2,4,7-trimethyl-1H-indol-3-yl)propan-1-amine.
| Compound Name | 3-(2,4,7-trimethyl-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 82393603 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(2,4,7-trimethyl-1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1[nH]c2c(C)ccc(C)c2c1CCCN |
| InChI | InChI=1S/C14H20N2/c1-9-6-7-10(2)14-13(9)12(5-4-8-15)11(3)16-14/h6-7,16H,4-5,8,15H2,1-3H3 |
| InChIKey | SYXINEFRKVYQSV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |