C11H11ClFN — CID 130050200
3-(chloromethyl)-4-fluoro-2,7-dimethyl-1H-indole (PubChem CID 130050200) has the molecular formula C11H11ClFN and a molecular weight of 211.67 g/mol. Its IUPAC name is 3-(chloromethyl)-4-fluoro-2,7-dimethyl-1H-indole.
| Compound Name | 3-(chloromethyl)-4-fluoro-2,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 130050200 |
| Molecular Formula | C11H11ClFN |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 3-(chloromethyl)-4-fluoro-2,7-dimethyl-1H-indole |
| SMILES | Cc1[nH]c2c(C)ccc(F)c2c1CCl |
| InChI | InChI=1S/C11H11ClFN/c1-6-3-4-9(13)10-8(5-12)7(2)14-11(6)10/h3-4,14H,5H2,1-2H3 |
| InChIKey | RUWHITUKMFKXNZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|