C15H22N2 — CID 82495305
N-ethyl-2-(2,4,7-trimethyl-1H-indol-3-yl)ethanamine (PubChem CID 82495305) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-ethyl-2-(2,4,7-trimethyl-1H-indol-3-yl)ethanamine.
| Compound Name | N-ethyl-2-(2,4,7-trimethyl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82495305 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-ethyl-2-(2,4,7-trimethyl-1H-indol-3-yl)ethanamine |
| SMILES | CCNCCc1c(C)[nH]c2c(C)ccc(C)c12 |
| InChI | InChI=1S/C15H22N2/c1-5-16-9-8-13-12(4)17-15-11(3)7-6-10(2)14(13)15/h6-7,16-17H,5,8-9H2,1-4H3 |
| InChIKey | SDUXZHFDXGZINL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|