C21H20F2N2O2 — CID 91138796
N-[2-(4,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 91138796) has the molecular formula C21H20F2N2O2 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[2-(4,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-(4,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91138796 |
| Molecular Formula | C21H20F2N2O2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[2-(4,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCCc2c(C)[nH]c3c(F)ccc(F)c23)cc1 |
| InChI | InChI=1S/C21H20F2N2O2/c1-13-16(20-17(22)8-9-18(23)21(20)25-13)11-12-24-19(26)10-5-14-3-6-15(27-2)7-4-14/h3-10,25H,11-12H2,1-2H3,(H,24,26) |
| InChIKey | SHPFNMGQJJVGFJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|