C26H31FN4O — CID 69174813
N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-3-[3-(piperazin-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 69174813) has the molecular formula C26H31FN4O and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-3-[3-(piperazin-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-3-[3-(piperazin-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69174813 |
| Molecular Formula | C26H31FN4O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]-3-[3-(piperazin-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | Cc1[nH]c2c(F)ccc(C)c2c1CCNC(=O)C=Cc1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C26H31FN4O/c1-18-6-8-23(27)26-25(18)22(19(2)30-26)10-11-29-24(32)9-7-20-4-3-5-21(16-20)17-31-14-12-28-13-15-31/h3-9,16,28,30H,10-15,17H2,1-2H3,(H,29,32) |
| InChIKey | NBIMNDBTTRYSLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|