C23H23FN2O3 — CID 163689140
3-[(E)-3-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethylamino]-2-methyl-3-oxoprop-1-enyl]benzoic acid (PubChem CID 163689140) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-[(E)-3-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethylamino]-2-methyl-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 3-[(E)-3-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethylamino]-2-methyl-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 163689140 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[(E)-3-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethylamino]-2-methyl-3-oxoprop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1cccc(C(=O)O)c1)C(=O)NCCc1c(C)[nH]c2c(F)ccc(C)c12 |
| InChI | InChI=1S/C23H23FN2O3/c1-13-7-8-19(24)21-20(13)18(15(3)26-21)9-10-25-22(27)14(2)11-16-5-4-6-17(12-16)23(28)29/h4-8,11-12,26H,9-10H2,1-3H3,(H,25,27)(H,28,29)/b14-11+ |
| InChIKey | JRLJQVXGUJBRKK-SDNWHVSQSA-N |
| XLogP | 4.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|