C23H26FN3O — CID 25160176
(E)-3-[4-(dimethylamino)phenyl]-N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 25160176) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 25160176 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-N-[2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1[nH]c2c(F)ccc(C)c2c1CCNC(=O)/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H26FN3O/c1-15-5-11-20(24)23-22(15)19(16(2)26-23)13-14-25-21(28)12-8-17-6-9-18(10-7-17)27(3)4/h5-12,26H,13-14H2,1-4H3,(H,25,28)/b12-8+ |
| InChIKey | QDQDHADGFFVSOQ-XYOKQWHBSA-N |
| XLogP | 4.36 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|