C23H24F2N2O4 — CID 71499417
(E)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 71499417) has the molecular formula C23H24F2N2O4 and a molecular weight of 430.45 g/mol. Its IUPAC name is (E)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71499417 |
| Molecular Formula | C23H24F2N2O4 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (E)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCc2c(C)[nH]c3c(F)cc(F)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H24F2N2O4/c1-13-16(17-11-15(24)12-18(25)22(17)27-13)7-8-26-21(28)6-5-14-9-19(29-2)23(31-4)20(10-14)30-3/h5-6,9-12,27H,7-8H2,1-4H3,(H,26,28)/b6-5+ |
| InChIKey | BVBCFENETKDJRG-AATRIKPKSA-N |
| XLogP | 4.15 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|