C30H38N2O10 — CID 15957875
methyl 2,5-bis[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pentanoate (PubChem CID 15957875) has the molecular formula C30H38N2O10 and a molecular weight of 586.64 g/mol. Its IUPAC name is methyl 2,5-bis[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pentanoate.
| Compound Name | methyl 2,5-bis[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pentanoate |
|---|---|
| PubChem CID | 15957875 |
| Molecular Formula | C30H38N2O10 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | methyl 2,5-bis[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pentanoate |
| SMILES | COC(=O)C(CCCNC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1)NC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H38N2O10/c1-36-22-15-19(16-23(37-2)28(22)40-5)10-12-26(33)31-14-8-9-21(30(35)42-7)32-27(34)13-11-20-17-24(38-3)29(41-6)25(18-20)39-4/h10-13,15-18,21H,8-9,14H2,1-7H3,(H,31,33)(H,32,34)/b12-10+,13-11+ |
| InChIKey | JCCLXGSHYGOPBY-DCIPZJNNSA-N |
| XLogP | 3.02 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|