C35H44N2O10 — CID 20691749
methyl (2S)-2,6-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]hexanoate (PubChem CID 20691749) has the molecular formula C35H44N2O10 and a molecular weight of 652.74 g/mol. Its IUPAC name is methyl (2S)-2,6-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]hexanoate.
| Compound Name | methyl (2S)-2,6-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]hexanoate |
|---|---|
| PubChem CID | 20691749 |
| Molecular Formula | C35H44N2O10 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | methyl (2S)-2,6-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)/C=C/C=C/c1cc(OC)c(OC)c(OC)c1)NC(=O)/C=C/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C35H44N2O10/c1-41-27-20-24(21-28(42-2)33(27)45-5)14-8-10-17-31(38)36-19-13-12-16-26(35(40)47-7)37-32(39)18-11-9-15-25-22-29(43-3)34(46-6)30(23-25)44-4/h8-11,14-15,17-18,20-23,26H,12-13,16,19H2,1-7H3,(H,36,38)(H,37,39)/b14-8+,15-9+,17-10+,18-11+/t26-/m0/s1 |
| InChIKey | JWICKYNCVQHAEH-ACJQGFSGSA-N |
| XLogP | 4.52 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|