C17H24N2O8 — CID 161089013
N-(3-hydroxypropyl)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide;nitric acid (PubChem CID 161089013) has the molecular formula C17H24N2O8 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide;nitric acid.
| Compound Name | N-(3-hydroxypropyl)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide;nitric acid |
|---|---|
| PubChem CID | 161089013 |
| Molecular Formula | C17H24N2O8 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(3-hydroxypropyl)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide;nitric acid |
| SMILES | COc1cc(C=CC=CC(=O)NCCCO)cc(OC)c1OC.O=[N+]([O-])O |
| InChI | InChI=1S/C17H23NO5.HNO3/c1-21-14-11-13(12-15(22-2)17(14)23-3)7-4-5-8-16(20)18-9-6-10-19;2-1(3)4/h4-5,7-8,11-12,19H,6,9-10H2,1-3H3,(H,18,20);(H,2,3,4) |
| InChIKey | UGXNOWWXROFTIU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|