C41H52NO7PS — CID 139388728
methanesulfonate;triphenyl-[10-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]decyl]phosphanium (PubChem CID 139388728) has the molecular formula C41H52NO7PS and a molecular weight of 733.91 g/mol. Its IUPAC name is methanesulfonate;triphenyl-[10-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]decyl]phosphanium.
| Compound Name | methanesulfonate;triphenyl-[10-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]decyl]phosphanium |
|---|---|
| PubChem CID | 139388728 |
| Molecular Formula | C41H52NO7PS |
| Molecular Weight | 733.91 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | methanesulfonate;triphenyl-[10-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]decyl]phosphanium |
| SMILES | COc1cc(C=CC(=O)NCCCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C40H48NO4P.CH4O3S/c1-43-37-31-33(32-38(44-2)40(37)45-3)27-28-39(42)41-29-19-8-6-4-5-7-9-20-30-46(34-21-13-10-14-22-34,35-23-15-11-16-24-35)36-25-17-12-18-26-36;1-5(2,3)4/h10-18,21-28,31-32H,4-9,19-20,29-30H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | MDALOMZYBIQPHW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.91 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|