C36H42NO6PS — CID 174955749
8-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]octyl-triphenylphosphanium;methanesulfonate (PubChem CID 174955749) has the molecular formula C36H42NO6PS and a molecular weight of 647.77 g/mol. Its IUPAC name is 8-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]octyl-triphenylphosphanium;methanesulfonate.
| Compound Name | 8-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]octyl-triphenylphosphanium;methanesulfonate |
|---|---|
| PubChem CID | 174955749 |
| Molecular Formula | C36H42NO6PS |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | 8-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]octyl-triphenylphosphanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].O=C(C=Cc1ccc(O)c(O)c1)NCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38NO3P.CH4O3S/c37-33-24-22-29(28-34(33)38)23-25-35(39)36-26-14-3-1-2-4-15-27-40(30-16-8-5-9-17-30,31-18-10-6-11-19-31)32-20-12-7-13-21-32;1-5(2,3)4/h5-13,16-25,28H,1-4,14-15,26-27H2,(H2-,36,37,38,39);1H3,(H,2,3,4) |
| InChIKey | GXICTAFLKNSUQR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|