C37H45NO3P+ — CID 155518953
10-[3-(3,4-dihydroxyphenyl)propanoylamino]decyl-triphenylphosphanium (PubChem CID 155518953) has the molecular formula C37H45NO3P+ and a molecular weight of 582.75 g/mol. Its IUPAC name is 10-[3-(3,4-dihydroxyphenyl)propanoylamino]decyl-triphenylphosphanium.
| Compound Name | 10-[3-(3,4-dihydroxyphenyl)propanoylamino]decyl-triphenylphosphanium |
|---|---|
| PubChem CID | 155518953 |
| Molecular Formula | C37H45NO3P+ |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 10-[3-(3,4-dihydroxyphenyl)propanoylamino]decyl-triphenylphosphanium |
| SMILES | O=C(CCc1ccc(O)c(O)c1)NCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44NO3P/c39-35-26-24-31(30-36(35)40)25-27-37(41)38-28-16-5-3-1-2-4-6-17-29-42(32-18-10-7-11-19-32,33-20-12-8-13-21-33)34-22-14-9-15-23-34/h7-15,18-24,26,30H,1-6,16-17,25,27-29H2,(H2-,38,39,40,41)/p+1 |
| InChIKey | FLUKUPMAUICSAY-UHFFFAOYSA-O |
| XLogP | 7.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|