C32H41N3O6 — CID 101096528
N-[3-[4-(benzylamino)butyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]propyl]-3-(3,4-dihydroxyphenyl)propanamide (PubChem CID 101096528) has the molecular formula C32H41N3O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is N-[3-[4-(benzylamino)butyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]propyl]-3-(3,4-dihydroxyphenyl)propanamide.
| Compound Name | N-[3-[4-(benzylamino)butyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]propyl]-3-(3,4-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 101096528 |
| Molecular Formula | C32H41N3O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | N-[3-[4-(benzylamino)butyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]propyl]-3-(3,4-dihydroxyphenyl)propanamide |
| SMILES | O=C(CCc1ccc(O)c(O)c1)NCCCN(CCCCNCc1ccccc1)C(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C32H41N3O6/c36-27-13-9-24(21-29(27)38)11-15-31(40)34-18-6-20-35(19-5-4-17-33-23-26-7-2-1-3-8-26)32(41)16-12-25-10-14-28(37)30(39)22-25/h1-3,7-10,13-14,21-22,33,36-39H,4-6,11-12,15-20,23H2,(H,34,40) |
| InChIKey | PCGMRBKPQHMPEA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|