C21H27N3O6 — CID 71541168
2-(3,4-dihydroxyphenyl)-N-[3-[2-[[2-(3,4-dihydroxyphenyl)acetyl]amino]ethylamino]propyl]acetamide (PubChem CID 71541168) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-N-[3-[2-[[2-(3,4-dihydroxyphenyl)acetyl]amino]ethylamino]propyl]acetamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-N-[3-[2-[[2-(3,4-dihydroxyphenyl)acetyl]amino]ethylamino]propyl]acetamide |
|---|---|
| PubChem CID | 71541168 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-[3-[2-[[2-(3,4-dihydroxyphenyl)acetyl]amino]ethylamino]propyl]acetamide |
| SMILES | O=C(Cc1ccc(O)c(O)c1)NCCCNCCNC(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H27N3O6/c25-16-4-2-14(10-18(16)27)12-20(29)23-7-1-6-22-8-9-24-21(30)13-15-3-5-17(26)19(28)11-15/h2-5,10-11,22,25-28H,1,6-9,12-13H2,(H,23,29)(H,24,30) |
| InChIKey | VGUNMPLQMXSZAS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|