C23H32N3O6+ — CID 71597204
4-[[2-(3,4-dihydroxyphenyl)acetyl]amino]butyl-[3-[[2-(3,4-dihydroxyphenyl)acetyl]amino]propyl]azanium (PubChem CID 71597204) has the molecular formula C23H32N3O6+ and a molecular weight of 446.52 g/mol. Its IUPAC name is 4-[[2-(3,4-dihydroxyphenyl)acetyl]amino]butyl-[3-[[2-(3,4-dihydroxyphenyl)acetyl]amino]propyl]azanium.
| Compound Name | 4-[[2-(3,4-dihydroxyphenyl)acetyl]amino]butyl-[3-[[2-(3,4-dihydroxyphenyl)acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 71597204 |
| Molecular Formula | C23H32N3O6+ |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-[[2-(3,4-dihydroxyphenyl)acetyl]amino]butyl-[3-[[2-(3,4-dihydroxyphenyl)acetyl]amino]propyl]azanium |
| SMILES | O=C(Cc1ccc(O)c(O)c1)NCCCC[NH2+]CCCNC(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H31N3O6/c27-18-6-4-16(12-20(18)29)14-22(31)25-10-2-1-8-24-9-3-11-26-23(32)15-17-5-7-19(28)21(30)13-17/h4-7,12-13,24,27-30H,1-3,8-11,14-15H2,(H,25,31)(H,26,32)/p+1 |
| InChIKey | QNQHXGWBRGEDIL-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|