C25H35N3O6 — CID 101096520
N-[4-[3-aminopropyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)propanamide (PubChem CID 101096520) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[4-[3-aminopropyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)propanamide.
| Compound Name | N-[4-[3-aminopropyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 101096520 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[4-[3-aminopropyl-[3-(3,4-dihydroxyphenyl)propanoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)propanamide |
| SMILES | NCCCN(CCCCNC(=O)CCc1ccc(O)c(O)c1)C(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H35N3O6/c26-12-3-15-28(25(34)11-7-19-5-9-21(30)23(32)17-19)14-2-1-13-27-24(33)10-6-18-4-8-20(29)22(31)16-18/h4-5,8-9,16-17,29-32H,1-3,6-7,10-15,26H2,(H,27,33) |
| InChIKey | LMPWHHKYDRFIOT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|