C28H42N4O6 — CID 67172606
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dihydroxyphenyl)-N-[3-(3,4-dihydroxyphenyl)propanoyl]propanamide (PubChem CID 67172606) has the molecular formula C28H42N4O6 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dihydroxyphenyl)-N-[3-(3,4-dihydroxyphenyl)propanoyl]propanamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dihydroxyphenyl)-N-[3-(3,4-dihydroxyphenyl)propanoyl]propanamide |
|---|---|
| PubChem CID | 67172606 |
| Molecular Formula | C28H42N4O6 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-3-(3,4-dihydroxyphenyl)-N-[3-(3,4-dihydroxyphenyl)propanoyl]propanamide |
| SMILES | NCCCNCCCCNCCCN(C(=O)CCc1ccc(O)c(O)c1)C(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H42N4O6/c29-13-3-16-30-14-1-2-15-31-17-4-18-32(27(37)11-7-21-5-9-23(33)25(35)19-21)28(38)12-8-22-6-10-24(34)26(36)20-22/h5-6,9-10,19-20,30-31,33-36H,1-4,7-8,11-18,29H2 |
| InChIKey | HSDOQVDMYCJLJL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|