C25H41NO5 — CID 118860312
3-methylbutyl 11-[3-(3,4-dihydroxyphenyl)propanoylamino]undecanoate (PubChem CID 118860312) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is 3-methylbutyl 11-[3-(3,4-dihydroxyphenyl)propanoylamino]undecanoate.
| Compound Name | 3-methylbutyl 11-[3-(3,4-dihydroxyphenyl)propanoylamino]undecanoate |
|---|---|
| PubChem CID | 118860312 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 3-methylbutyl 11-[3-(3,4-dihydroxyphenyl)propanoylamino]undecanoate |
| SMILES | CC(C)CCOC(=O)CCCCCCCCCCNC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H41NO5/c1-20(2)16-18-31-25(30)11-9-7-5-3-4-6-8-10-17-26-24(29)15-13-21-12-14-22(27)23(28)19-21/h12,14,19-20,27-28H,3-11,13,15-18H2,1-2H3,(H,26,29) |
| InChIKey | ZPJGPEQMAKLJIB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|