C22H35NO6 — CID 177320797
[2-methyl-2-(3-methylbutoxy)propyl] 5-[2-(3,4-dihydroxyphenyl)ethylamino]-5-oxopentanoate (PubChem CID 177320797) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is [2-methyl-2-(3-methylbutoxy)propyl] 5-[2-(3,4-dihydroxyphenyl)ethylamino]-5-oxopentanoate.
| Compound Name | [2-methyl-2-(3-methylbutoxy)propyl] 5-[2-(3,4-dihydroxyphenyl)ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 177320797 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | [2-methyl-2-(3-methylbutoxy)propyl] 5-[2-(3,4-dihydroxyphenyl)ethylamino]-5-oxopentanoate |
| SMILES | CC(C)CCOC(C)(C)COC(=O)CCCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H35NO6/c1-16(2)11-13-29-22(3,4)15-28-21(27)7-5-6-20(26)23-12-10-17-8-9-18(24)19(25)14-17/h8-9,14,16,24-25H,5-7,10-13,15H2,1-4H3,(H,23,26) |
| InChIKey | FCCKEVXBQYXJNT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|