C16H21NO8 — CID 177003723
5-[1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethoxy]-5-oxopentanoic acid (PubChem CID 177003723) has the molecular formula C16H21NO8 and a molecular weight of 355.34 g/mol. Its IUPAC name is 5-[1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethoxy]-5-oxopentanoic acid.
| Compound Name | 5-[1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177003723 |
| Molecular Formula | C16H21NO8 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 5-[1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethoxy]-5-oxopentanoic acid |
| SMILES | CC(OC(=O)CCCC(=O)O)OC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H21NO8/c1-10(24-15(22)4-2-3-14(20)21)25-16(23)17-8-7-11-5-6-12(18)13(19)9-11/h5-6,9-10,18-19H,2-4,7-8H2,1H3,(H,17,23)(H,20,21) |
| InChIKey | ZUMGHFQVHSSMFA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|