C17H26N2O6 — CID 177003732
1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethyl 6-aminohexanoate (PubChem CID 177003732) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethyl 6-aminohexanoate.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethyl 6-aminohexanoate |
|---|---|
| PubChem CID | 177003732 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)ethylcarbamoyloxy]ethyl 6-aminohexanoate |
| SMILES | CC(OC(=O)CCCCCN)OC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H26N2O6/c1-12(24-16(22)5-3-2-4-9-18)25-17(23)19-10-8-13-6-7-14(20)15(21)11-13/h6-7,11-12,20-21H,2-5,8-10,18H2,1H3,(H,19,23) |
| InChIKey | XFXRFQHJQPPBPM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|