C41H65NO13 — CID 165070846
1-O-ethyl 8-O-[6-oxo-6-[4-[6-(propylcarbamoyloxy)hexanoyloxy]butoxy]hexyl] 2-[5-(3,4-dihydroxyphenyl)-2-oxopentyl]octanedioate (PubChem CID 165070846) has the molecular formula C41H65NO13 and a molecular weight of 779.96 g/mol. Its IUPAC name is 1-O-ethyl 8-O-[6-oxo-6-[4-[6-(propylcarbamoyloxy)hexanoyloxy]butoxy]hexyl] 2-[5-(3,4-dihydroxyphenyl)-2-oxopentyl]octanedioate.
| Compound Name | 1-O-ethyl 8-O-[6-oxo-6-[4-[6-(propylcarbamoyloxy)hexanoyloxy]butoxy]hexyl] 2-[5-(3,4-dihydroxyphenyl)-2-oxopentyl]octanedioate |
|---|---|
| PubChem CID | 165070846 |
| Molecular Formula | C41H65NO13 |
| Molecular Weight | 779.96 g/mol |
| Exact Mass | 779.45 |
| IUPAC Name | 1-O-ethyl 8-O-[6-oxo-6-[4-[6-(propylcarbamoyloxy)hexanoyloxy]butoxy]hexyl] 2-[5-(3,4-dihydroxyphenyl)-2-oxopentyl]octanedioate |
| SMILES | CCCNC(=O)OCCCCCC(=O)OCCCCOC(=O)CCCCCOC(=O)CCCCCC(CC(=O)CCCc1ccc(O)c(O)c1)C(=O)OCC |
| InChI | InChI=1S/C41H65NO13/c1-3-25-42-41(50)55-29-13-7-11-22-39(48)54-28-15-14-27-53-38(47)21-10-6-12-26-52-37(46)20-9-5-8-18-33(40(49)51-4-2)31-34(43)19-16-17-32-23-24-35(44)36(45)30-32/h23-24,30,33,44-45H,3-22,25-29,31H2,1-2H3,(H,42,50) |
| InChIKey | FCYZOGATJZPNKK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.96 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|