C18H25NO10 — CID 102239067
[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate (PubChem CID 102239067) has the molecular formula C18H25NO10 and a molecular weight of 415.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 102239067 |
| Molecular Formula | C18H25NO10 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[2-(3,4-dihydroxyphenyl)ethylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H25NO10/c20-10-2-1-9(7-11(10)21)5-6-19-13(22)3-4-14(23)28-8-12-15(24)16(25)17(26)18(27)29-12/h1-2,7,12,15-18,20-21,24-27H,3-6,8H2,(H,19,22)/t12-,15-,16+,17-,18+/m1/s1 |
| InChIKey | MUKGDFRXFWTDJT-CUWKQTPXSA-N |
| XLogP | -2.12 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|