C29H38O14 — CID 58038911
[(2R,3R,4S,5R,6R)-4-[(2S,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 58038911) has the molecular formula C29H38O14 and a molecular weight of 610.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-[(2S,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-4-[(2S,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 58038911 |
| Molecular Formula | C29H38O14 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-[(2S,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](OCCc3ccc(O)c(O)c3)O[C@H](COC(=O)CCc3ccc(O)c(O)c3)[C@H]2O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H38O14/c1-14-19(32)12-22(35)28(41-14)43-27-25(37)23(13-40-24(36)7-4-15-2-5-17(30)20(33)10-15)42-29(26(27)38)39-9-8-16-3-6-18(31)21(34)11-16/h2-3,5-6,10-11,14,19,22-23,25-35,37-38H,4,7-9,12-13H2,1H3/t14-,19+,22+,23+,25+,26+,27-,28-,29+/m0/s1 |
| InChIKey | KGHOLCLVHHNFAN-MOQAAJMVSA-N |
| XLogP | -0.07 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|