C21H26I2O12 — CID 158576391
3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one;6-(hydroxymethyl)oxane-2,3,4,5-tetrol;molecular iodine (PubChem CID 158576391) has the molecular formula C21H26I2O12 and a molecular weight of 724.23 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one;6-(hydroxymethyl)oxane-2,3,4,5-tetrol;molecular iodine.
| Compound Name | 3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one;6-(hydroxymethyl)oxane-2,3,4,5-tetrol;molecular iodine |
|---|---|
| PubChem CID | 158576391 |
| Molecular Formula | C21H26I2O12 |
| Molecular Weight | 724.23 g/mol |
| Exact Mass | 723.95 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one;6-(hydroxymethyl)oxane-2,3,4,5-tetrol;molecular iodine |
| SMILES | II.O=C(CCc1ccc(O)c(O)c1)c1c(O)cc(O)cc1O.OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C15H14O6.C6H12O6.I2/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8;7-1-2-3(8)4(9)5(10)6(11)12-2;1-2/h1,3,5-7,16-17,19-21H,2,4H2;2-11H,1H2; |
| InChIKey | HSSCSXVOBNZJQL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 228.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|