C22H26O11 — CID 163469369
1-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-2,4,6-trihydroxyphenyl]-3-(3,4-dihydroxyphenyl)propan-1-one (PubChem CID 163469369) has the molecular formula C22H26O11 and a molecular weight of 466.44 g/mol. Its IUPAC name is 1-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-2,4,6-trihydroxyphenyl]-3-(3,4-dihydroxyphenyl)propan-1-one.
| Compound Name | 1-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-2,4,6-trihydroxyphenyl]-3-(3,4-dihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 163469369 |
| Molecular Formula | C22H26O11 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[3-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-2,4,6-trihydroxyphenyl]-3-(3,4-dihydroxyphenyl)propan-1-one |
| SMILES | COC1C(CO)OC(c2c(O)cc(O)c(C(=O)CCc3ccc(O)c(O)c3)c2O)C(O)C1O |
| InChI | InChI=1S/C22H26O11/c1-32-21-15(8-23)33-22(20(31)19(21)30)17-14(28)7-13(27)16(18(17)29)11(25)5-3-9-2-4-10(24)12(26)6-9/h2,4,6-7,15,19-24,26-31H,3,5,8H2,1H3 |
| InChIKey | BVHLOOLYKTYNLI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|