C22H26O10 — CID 101049645
1-[2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one (PubChem CID 101049645) has the molecular formula C22H26O10 and a molecular weight of 450.44 g/mol. Its IUPAC name is 1-[2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one.
| Compound Name | 1-[2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 101049645 |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-[2-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methoxyoxan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](Oc2cc(O)cc(O)c2C(=O)CCc2ccc(O)cc2)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C22H26O10/c1-30-21-19(28)17(10-23)32-22(20(21)29)31-16-9-13(25)8-15(27)18(16)14(26)7-4-11-2-5-12(24)6-3-11/h2-3,5-6,8-9,17,19-25,27-29H,4,7,10H2,1H3/t17-,19-,20-,21+,22-/m1/s1 |
| InChIKey | QFUQUZDKFKPDFP-OHLDOZIISA-N |
| XLogP | 0.45 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |