C25H28O12 — CID 171337357
[(2R,3S,4S,5R,6S)-5-acetyloxy-6-[3,5-dihydroxy-2-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4-dihydroxyoxan-2-yl]methyl acetate (PubChem CID 171337357) has the molecular formula C25H28O12 and a molecular weight of 520.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[3,5-dihydroxy-2-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4-dihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[3,5-dihydroxy-2-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4-dihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171337357 |
| Molecular Formula | C25H28O12 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[3,5-dihydroxy-2-[3-(4-hydroxyphenyl)propanoyl]phenoxy]-3,4-dihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(O)cc(O)c2C(=O)CCc2ccc(O)cc2)[C@H](OC(C)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H28O12/c1-12(26)34-11-20-22(32)23(33)24(35-13(2)27)25(37-20)36-19-10-16(29)9-18(31)21(19)17(30)8-5-14-3-6-15(28)7-4-14/h3-4,6-7,9-10,20,22-25,28-29,31-33H,5,8,11H2,1-2H3/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | RNFUDMLDNQMVQG-PRDVQWLOSA-N |
| XLogP | 0.94 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |